C26H38O9 — CID 86304592
[(1R,10S,12R,16S)-5,6,11,13-tetrahydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-14-yl] hexanoate (PubChem CID 86304592) has the molecular formula C26H38O9 and a molecular weight of 494.58 g/mol. Its IUPAC name is [(1R,10S,12R,16S)-5,6,11,13-tetrahydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-14-yl] hexanoate.
| Compound Name | [(1R,10S,12R,16S)-5,6,11,13-tetrahydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-14-yl] hexanoate |
|---|---|
| PubChem CID | 86304592 |
| Molecular Formula | C26H38O9 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | [(1R,10S,12R,16S)-5,6,11,13-tetrahydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-14-yl] hexanoate |
| SMILES | CCCCCC(=O)OC12C(O)[C@@H](C)C3(O)[C@@H]4C=C(C)C(=O)C4(O)C(O)C4(CO)OC4[C@H]3[C@H]1C2(C)C |
| InChI | InChI=1S/C26H38O9/c1-6-7-8-9-15(28)34-26-17(22(26,4)5)16-20-23(11-27,35-20)21(31)25(33)14(10-12(2)18(25)29)24(16,32)13(3)19(26)30/h10,13-14,16-17,19-21,27,30-33H,6-9,11H2,1-5H3/t13-,14+,16-,17+,19?,20?,21?,23?,24?,25?,26?/m1/s1 |
| InChIKey | GTMWRVKYJVHQIP-YHSWYKMSSA-N |
| XLogP | 0.24 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|