C14H27N3O8 — CID 86305080
3-[[(1S,3R,4R,6S)-3-(2-carboxyethylamino)-2,4,6-trihydroxy-5-(2-hydroxyethylamino)cyclohexyl]amino]propanoic acid (PubChem CID 86305080) has the molecular formula C14H27N3O8 and a molecular weight of 365.38 g/mol. Its IUPAC name is 3-[[(1S,3R,4R,6S)-3-(2-carboxyethylamino)-2,4,6-trihydroxy-5-(2-hydroxyethylamino)cyclohexyl]amino]propanoic acid.
| Compound Name | 3-[[(1S,3R,4R,6S)-3-(2-carboxyethylamino)-2,4,6-trihydroxy-5-(2-hydroxyethylamino)cyclohexyl]amino]propanoic acid |
|---|---|
| PubChem CID | 86305080 |
| Molecular Formula | C14H27N3O8 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 3-[[(1S,3R,4R,6S)-3-(2-carboxyethylamino)-2,4,6-trihydroxy-5-(2-hydroxyethylamino)cyclohexyl]amino]propanoic acid |
| SMILES | O=C(O)CCN[C@@H]1C(O)[C@H](NCCC(=O)O)[C@H](O)C(NCCO)[C@@H]1O |
| InChI | InChI=1S/C14H27N3O8/c18-6-5-17-11-13(24)9(15-3-1-7(19)20)12(23)10(14(11)25)16-4-2-8(21)22/h9-18,23-25H,1-6H2,(H,19,20)(H,21,22)/t9-,10+,11?,12?,13-,14+ |
| InChIKey | ZNBSHHJPSMFDKG-LHQMGJFGSA-N |
| XLogP | -4.10 |
| TPSA | 191.61 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |