C15H29N3O9 — CID 86305082
3-[[(1R,3S,4S,6R)-3-(2-carboxyethylamino)-5-(2,3-dihydroxypropylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid (PubChem CID 86305082) has the molecular formula C15H29N3O9 and a molecular weight of 395.41 g/mol. Its IUPAC name is 3-[[(1R,3S,4S,6R)-3-(2-carboxyethylamino)-5-(2,3-dihydroxypropylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid.
| Compound Name | 3-[[(1R,3S,4S,6R)-3-(2-carboxyethylamino)-5-(2,3-dihydroxypropylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid |
|---|---|
| PubChem CID | 86305082 |
| Molecular Formula | C15H29N3O9 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 3-[[(1R,3S,4S,6R)-3-(2-carboxyethylamino)-5-(2,3-dihydroxypropylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid |
| SMILES | O=C(O)CCN[C@@H]1C(O)[C@H](NCCC(=O)O)[C@H](O)C(NCC(O)CO)[C@@H]1O |
| InChI | InChI=1S/C15H29N3O9/c19-6-7(20)5-18-12-14(26)10(16-3-1-8(21)22)13(25)11(15(12)27)17-4-2-9(23)24/h7,10-20,25-27H,1-6H2,(H,21,22)(H,23,24)/t7?,10-,11+,12?,13?,14-,15+ |
| InChIKey | VXGURGXFJXQFMN-KSYISCNLSA-N |
| XLogP | -4.74 |
| TPSA | 211.84 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |