C26H29N5O2S — CID 86305818
2-phenyl-N-[7-(4-pyridin-3-yltriazol-1-yl)heptyl]benzenesulfonamide (PubChem CID 86305818) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is 2-phenyl-N-[7-(4-pyridin-3-yltriazol-1-yl)heptyl]benzenesulfonamide.
| Compound Name | 2-phenyl-N-[7-(4-pyridin-3-yltriazol-1-yl)heptyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86305818 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-phenyl-N-[7-(4-pyridin-3-yltriazol-1-yl)heptyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCCCCn1cc(-c2cccnc2)nn1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H29N5O2S/c32-34(33,26-16-8-7-15-24(26)22-12-5-4-6-13-22)28-18-9-2-1-3-10-19-31-21-25(29-30-31)23-14-11-17-27-20-23/h4-8,11-17,20-21,28H,1-3,9-10,18-19H2 |
| InChIKey | AYJXFYDSGZJWNF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|