About 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide
6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 86305858) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
Molecular Properties
| Compound Name | 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| PubChem CID | 86305858 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | NC(=O)N1CCCc2cc(-c3cncc(C4CCOCC4)c3)cnc21 |
| InChI | InChI=1S/C19H22N4O2/c20-19(24)23-5-1-2-14-8-17(12-22-18(14)23)16-9-15(10-21-11-16)13-3-6-25-7-4-13/h8-13H,1-7H2,(H2,20,24) |
| InChIKey | VLCVBZZBBVPFJM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide?
The IUPAC name of 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (CID 86305858) is 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
What is the SMILES notation for 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide?
The canonical SMILES for 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide is NC(=O)N1CCCc2cc(-c3cncc(C4CCOCC4)c3)cnc21.
What is the InChIKey of 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide?
The InChIKey is VLCVBZZBBVPFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2/c20-19(24)23-5-1-2-14-8-17(12-22-18(14)23)16-9-15(10-21-11-16)13-3-6-25-7-4-13/h8-13H,1-7H2,(H2,20,24).
What are the key properties of 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide?
6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide has a molecular weight of 338.41 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(oxan-4-yl)-3-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide is sourced from PubChem (CID 86305858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).