C7H10NO4- — CID 86306397
(2R,6S)-piperidin-1-ium-2,6-dicarboxylate (PubChem CID 86306397) has the molecular formula C7H10NO4- and a molecular weight of 172.16 g/mol. Its IUPAC name is (2R,6S)-piperidin-1-ium-2,6-dicarboxylate.
| Compound Name | (2R,6S)-piperidin-1-ium-2,6-dicarboxylate |
|---|---|
| PubChem CID | 86306397 |
| Molecular Formula | C7H10NO4- |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | (2R,6S)-piperidin-1-ium-2,6-dicarboxylate |
| SMILES | O=C([O-])[C@@H]1CCC[C@H](C(=O)[O-])[NH2+]1 |
| InChI | InChI=1S/C7H11NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/p-1/t4-,5+ |
| InChIKey | SOOPBZRXJMNXTF-SYDPRGILSA-M |
| XLogP | -4.03 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |