About [(1R,2R)-2-aminocyclopropyl]azanium
[(1R,2R)-2-aminocyclopropyl]azanium (PubChem CID 86306440) has the molecular formula C3H9N2+
and a molecular weight of 73.12 g/mol. Its IUPAC name is [(1R,2R)-2-aminocyclopropyl]azanium.
Molecular Properties
| Compound Name | [(1R,2R)-2-aminocyclopropyl]azanium |
| PubChem CID | 86306440 |
| Molecular Formula | C3H9N2+ |
| Molecular Weight | 73.12 g/mol |
| Exact Mass | 73.08 |
| IUPAC Name | [(1R,2R)-2-aminocyclopropyl]azanium |
| SMILES | N[C@@H]1C[C@H]1[NH3+] |
| InChI | InChI=1S/C3H8N2/c4-2-1-3(2)5/h2-3H,1,4-5H2/p+1/t2-,3-/m1/s1 |
| InChIKey | DQSBSLFFVASXRY-PWNYCUMCSA-O |
| XLogP | -1.67 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.12 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1R,2R)-2-aminocyclopropyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-aminocyclopropyl]azanium?
The IUPAC name of [(1R,2R)-2-aminocyclopropyl]azanium (CID 86306440) is [(1R,2R)-2-aminocyclopropyl]azanium.
What is the SMILES notation for [(1R,2R)-2-aminocyclopropyl]azanium?
The canonical SMILES for [(1R,2R)-2-aminocyclopropyl]azanium is N[C@@H]1C[C@H]1[NH3+].
What is the InChIKey of [(1R,2R)-2-aminocyclopropyl]azanium?
The InChIKey is DQSBSLFFVASXRY-PWNYCUMCSA-O. The full InChI is InChI=1S/C3H8N2/c4-2-1-3(2)5/h2-3H,1,4-5H2/p+1/t2-,3-/m1/s1.
What are the key properties of [(1R,2R)-2-aminocyclopropyl]azanium?
[(1R,2R)-2-aminocyclopropyl]azanium has a molecular weight of 73.12 g/mol, XLogP of -1.67, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-aminocyclopropyl]azanium is sourced from PubChem (CID 86306440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).