About 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium
1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium (PubChem CID 86306459) has the molecular formula C6H10N3+
and a molecular weight of 124.17 g/mol. Its IUPAC name is 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium.
Molecular Properties
| Compound Name | 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium |
| PubChem CID | 86306459 |
| Molecular Formula | C6H10N3+ |
| Molecular Weight | 124.17 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium |
| SMILES | Cn1ncc2c1C[NH2+]C2 |
| InChI | InChI=1S/C6H9N3/c1-9-6-4-7-2-5(6)3-8-9/h3,7H,2,4H2,1H3/p+1 |
| InChIKey | ZPRTZMMXOLTYSI-UHFFFAOYSA-O |
| XLogP | -1.00 |
| TPSA | 34.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.17 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium?
The IUPAC name of 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium (CID 86306459) is 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium.
What is the SMILES notation for 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium?
The canonical SMILES for 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium is Cn1ncc2c1C[NH2+]C2.
What is the InChIKey of 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium?
The InChIKey is ZPRTZMMXOLTYSI-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H9N3/c1-9-6-4-7-2-5(6)3-8-9/h3,7H,2,4H2,1H3/p+1.
What are the key properties of 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium?
1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium has a molecular weight of 124.17 g/mol, XLogP of -1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5,6-dihydro-4H-pyrrolo[3,4-d]pyrazol-5-ium is sourced from PubChem (CID 86306459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).