About 5,6-dimethyl-1,3-benzothiazole-2-thiolate
5,6-dimethyl-1,3-benzothiazole-2-thiolate (PubChem CID 86307103) has the molecular formula C9H8NS2-
and a molecular weight of 194.30 g/mol. Its IUPAC name is 5,6-dimethyl-1,3-benzothiazole-2-thiolate.
Molecular Properties
| Compound Name | 5,6-dimethyl-1,3-benzothiazole-2-thiolate |
| PubChem CID | 86307103 |
| Molecular Formula | C9H8NS2- |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 5,6-dimethyl-1,3-benzothiazole-2-thiolate |
| SMILES | Cc1cc2nc([S-])sc2cc1C |
| InChI | InChI=1S/C9H9NS2/c1-5-3-7-8(4-6(5)2)12-9(11)10-7/h3-4H,1-2H3,(H,10,11)/p-1 |
| InChIKey | FFQWZJULSCUVRK-UHFFFAOYSA-M |
| XLogP | 2.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-1,3-benzothiazole-2-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-1,3-benzothiazole-2-thiolate?
The IUPAC name of 5,6-dimethyl-1,3-benzothiazole-2-thiolate (CID 86307103) is 5,6-dimethyl-1,3-benzothiazole-2-thiolate.
What is the SMILES notation for 5,6-dimethyl-1,3-benzothiazole-2-thiolate?
The canonical SMILES for 5,6-dimethyl-1,3-benzothiazole-2-thiolate is Cc1cc2nc([S-])sc2cc1C.
What is the InChIKey of 5,6-dimethyl-1,3-benzothiazole-2-thiolate?
The InChIKey is FFQWZJULSCUVRK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H9NS2/c1-5-3-7-8(4-6(5)2)12-9(11)10-7/h3-4H,1-2H3,(H,10,11)/p-1.
What are the key properties of 5,6-dimethyl-1,3-benzothiazole-2-thiolate?
5,6-dimethyl-1,3-benzothiazole-2-thiolate has a molecular weight of 194.30 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-1,3-benzothiazole-2-thiolate is sourced from PubChem (CID 86307103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).