C26H25NO4 — CID 86307440
(2S,3R)-3-azaniumyl-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-phenylpentanoate (PubChem CID 86307440) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is (2S,3R)-3-azaniumyl-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-phenylpentanoate.
| Compound Name | (2S,3R)-3-azaniumyl-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-phenylpentanoate |
|---|---|
| PubChem CID | 86307440 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (2S,3R)-3-azaniumyl-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-phenylpentanoate |
| SMILES | [NH3+][C@H](CCc1ccccc1)[C@@H](C(=O)[O-])C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H25NO4/c27-23(15-14-17-8-2-1-3-9-17)24(25(28)29)26(30)31-16-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-24H,14-16,27H2,(H,28,29)/t23-,24+/m1/s1 |
| InChIKey | YIUWAODYRXJUAX-RPWUZVMVSA-N |
| XLogP | 1.95 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|