About 6-oxopyran-2-carboxylate
6-oxopyran-2-carboxylate (PubChem CID 86308373) has the molecular formula C6H3O4-
and a molecular weight of 139.09 g/mol. Its IUPAC name is 6-oxopyran-2-carboxylate.
Molecular Properties
| Compound Name | 6-oxopyran-2-carboxylate |
| PubChem CID | 86308373 |
| Molecular Formula | C6H3O4- |
| Molecular Weight | 139.09 g/mol |
| Exact Mass | 139.00 |
| IUPAC Name | 6-oxopyran-2-carboxylate |
| SMILES | O=C([O-])c1cccc(=O)o1 |
| InChI | InChI=1S/C6H4O4/c7-5-3-1-2-4(10-5)6(8)9/h1-3H,(H,8,9)/p-1 |
| InChIKey | AUZCNXBFVCKKHV-UHFFFAOYSA-M |
| XLogP | -1.00 |
| TPSA | 70.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.09 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-oxopyran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxopyran-2-carboxylate?
The IUPAC name of 6-oxopyran-2-carboxylate (CID 86308373) is 6-oxopyran-2-carboxylate.
What is the SMILES notation for 6-oxopyran-2-carboxylate?
The canonical SMILES for 6-oxopyran-2-carboxylate is O=C([O-])c1cccc(=O)o1.
What is the InChIKey of 6-oxopyran-2-carboxylate?
The InChIKey is AUZCNXBFVCKKHV-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H4O4/c7-5-3-1-2-4(10-5)6(8)9/h1-3H,(H,8,9)/p-1.
What are the key properties of 6-oxopyran-2-carboxylate?
6-oxopyran-2-carboxylate has a molecular weight of 139.09 g/mol, XLogP of -1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxopyran-2-carboxylate is sourced from PubChem (CID 86308373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).