About (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane
(2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane (PubChem CID 86308801) has the molecular formula C4H4Br2ClF3
and a molecular weight of 304.33 g/mol. Its IUPAC name is (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane.
Molecular Properties
| Compound Name | (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane |
| PubChem CID | 86308801 |
| Molecular Formula | C4H4Br2ClF3 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 301.83 |
| IUPAC Name | (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane |
| SMILES | FC(F)(Br)[C@](F)(Cl)CCBr |
| InChI | InChI=1S/C4H4Br2ClF3/c5-2-1-3(7,8)4(6,9)10/h1-2H2/t3-/m0/s1 |
| InChIKey | RJOGGYLEOPNVJV-VKHMYHEASA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane?
The IUPAC name of (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane (CID 86308801) is (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane.
What is the SMILES notation for (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane?
The canonical SMILES for (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane is FC(F)(Br)[C@](F)(Cl)CCBr.
What is the InChIKey of (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane?
The InChIKey is RJOGGYLEOPNVJV-VKHMYHEASA-N. The full InChI is InChI=1S/C4H4Br2ClF3/c5-2-1-3(7,8)4(6,9)10/h1-2H2/t3-/m0/s1.
What are the key properties of (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane?
(2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane has a molecular weight of 304.33 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,4-dibromo-2-chloro-1,1,2-trifluorobutane is sourced from PubChem (CID 86308801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).