C9H10NO4- — CID 86309590
5-(2,5-dioxopyrrol-1-yl)pentanoate (PubChem CID 86309590) has the molecular formula C9H10NO4- and a molecular weight of 196.18 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)pentanoate.
| Compound Name | 5-(2,5-dioxopyrrol-1-yl)pentanoate |
|---|---|
| PubChem CID | 86309590 |
| Molecular Formula | C9H10NO4- |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)pentanoate |
| SMILES | O=C([O-])CCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO4/c11-7-4-5-8(12)10(7)6-2-1-3-9(13)14/h4-5H,1-3,6H2,(H,13,14)/p-1 |
| InChIKey | ACVAAFHNDGTZLL-UHFFFAOYSA-M |
| XLogP | -1.17 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|