C14H12Cl2O — CID 86310638
(1R)-1,2-bis(2-chlorophenyl)ethanol (PubChem CID 86310638) has the molecular formula C14H12Cl2O and a molecular weight of 267.16 g/mol. Its IUPAC name is (1R)-1,2-bis(2-chlorophenyl)ethanol.
| Compound Name | (1R)-1,2-bis(2-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 86310638 |
| Molecular Formula | C14H12Cl2O |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | (1R)-1,2-bis(2-chlorophenyl)ethanol |
| SMILES | O[C@H](Cc1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C14H12Cl2O/c15-12-7-3-1-5-10(12)9-14(17)11-6-2-4-8-13(11)16/h1-8,14,17H,9H2/t14-/m1/s1 |
| InChIKey | UEVUBLHRXJGLBD-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |