About (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine
(3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 86311394) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine.
Molecular Properties
| Compound Name | (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine |
| PubChem CID | 86311394 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | NC1=NC2=NC=C[C@@H]2C=C1 |
| InChI | InChI=1S/C7H7N3/c8-6-2-1-5-3-4-9-7(5)10-6/h1-5H,(H2,8,9,10)/t5-/m0/s1 |
| InChIKey | YTIGORGISAXJRK-YFKPBYRVSA-N |
| XLogP | 0.46 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine?
The IUPAC name of (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine (CID 86311394) is (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine.
What is the SMILES notation for (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine?
The canonical SMILES for (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine is NC1=NC2=NC=C[C@@H]2C=C1.
What is the InChIKey of (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine?
The InChIKey is YTIGORGISAXJRK-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H7N3/c8-6-2-1-5-3-4-9-7(5)10-6/h1-5H,(H2,8,9,10)/t5-/m0/s1.
What are the key properties of (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine?
(3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine has a molecular weight of 133.15 g/mol, XLogP of 0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS)-3aH-pyrrolo[2,3-b]pyridin-6-amine is sourced from PubChem (CID 86311394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).