C19H19ClN2O6 — CID 8631488
[(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-(4-chloro-2,6-dimethylphenoxy)acetate (PubChem CID 8631488) has the molecular formula C19H19ClN2O6 and a molecular weight of 406.82 g/mol. Its IUPAC name is [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-(4-chloro-2,6-dimethylphenoxy)acetate.
| Compound Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-(4-chloro-2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 8631488 |
| Molecular Formula | C19H19ClN2O6 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 2-(4-chloro-2,6-dimethylphenoxy)acetate |
| SMILES | Cc1cc(Cl)cc(C)c1OCC(=O)O[C@H](C)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19ClN2O6/c1-11-8-14(20)9-12(2)18(11)27-10-17(23)28-13(3)19(24)21-15-6-4-5-7-16(15)22(25)26/h4-9,13H,10H2,1-3H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | QCHBITFKJCVVKV-CYBMUJFWSA-N |
| XLogP | 3.81 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|