C10H5BrF3NO — CID 86314935
(2R)-2-(4-bromophenyl)-4,4,4-trifluoro-3-oxobutanenitrile (PubChem CID 86314935) has the molecular formula C10H5BrF3NO and a molecular weight of 292.05 g/mol. Its IUPAC name is (2R)-2-(4-bromophenyl)-4,4,4-trifluoro-3-oxobutanenitrile.
| Compound Name | (2R)-2-(4-bromophenyl)-4,4,4-trifluoro-3-oxobutanenitrile |
|---|---|
| PubChem CID | 86314935 |
| Molecular Formula | C10H5BrF3NO |
| Molecular Weight | 292.05 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | (2R)-2-(4-bromophenyl)-4,4,4-trifluoro-3-oxobutanenitrile |
| SMILES | N#C[C@H](C(=O)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H5BrF3NO/c11-7-3-1-6(2-4-7)8(5-15)9(16)10(12,13)14/h1-4,8H/t8-/m0/s1 |
| InChIKey | QDPGFJNPGSEFBX-QMMMGPOBSA-N |
| XLogP | 3.19 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.05 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |