About (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one
(2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one (PubChem CID 86318563) has the molecular formula C12H12Cl2O2
and a molecular weight of 259.13 g/mol. Its IUPAC name is (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one |
| PubChem CID | 86318563 |
| Molecular Formula | C12H12Cl2O2 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one |
| SMILES | CCC[C@H]1Cc2cc(O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C12H12Cl2O2/c1-2-3-6-4-7-5-8(15)10(13)11(14)9(7)12(6)16/h5-6,15H,2-4H2,1H3/t6-/m0/s1 |
| InChIKey | JVIURHJLQOAEEY-LURJTMIESA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one?
The IUPAC name of (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one (CID 86318563) is (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one.
What is the SMILES notation for (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one?
The canonical SMILES for (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one is CCC[C@H]1Cc2cc(O)c(Cl)c(Cl)c2C1=O.
What is the InChIKey of (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one?
The InChIKey is JVIURHJLQOAEEY-LURJTMIESA-N. The full InChI is InChI=1S/C12H12Cl2O2/c1-2-3-6-4-7-5-8(15)10(13)11(14)9(7)12(6)16/h5-6,15H,2-4H2,1H3/t6-/m0/s1.
What are the key properties of (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one?
(2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one has a molecular weight of 259.13 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6,7-dichloro-5-hydroxy-2-propyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 86318563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).