About (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine
(1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine (PubChem CID 86318697) has the molecular formula C7H6ClN3O2
and a molecular weight of 199.60 g/mol. Its IUPAC name is (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine |
| PubChem CID | 86318697 |
| Molecular Formula | C7H6ClN3O2 |
| Molecular Weight | 199.60 g/mol |
| Exact Mass | 199.01 |
| IUPAC Name | (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine |
| SMILES | O=[N+]([O-])c1cc2n(c1)C=CN[C@@H]2Cl |
| InChI | InChI=1S/C7H6ClN3O2/c8-7-6-3-5(11(12)13)4-10(6)2-1-9-7/h1-4,7,9H/t7-/m0/s1 |
| InChIKey | DQHMLPTYBMROHV-ZETCQYMHSA-N |
| XLogP | 1.67 |
| TPSA | 60.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.60 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine?
The IUPAC name of (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine (CID 86318697) is (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine.
What is the SMILES notation for (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine?
The canonical SMILES for (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine is O=[N+]([O-])c1cc2n(c1)C=CN[C@@H]2Cl.
What is the InChIKey of (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine?
The InChIKey is DQHMLPTYBMROHV-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H6ClN3O2/c8-7-6-3-5(11(12)13)4-10(6)2-1-9-7/h1-4,7,9H/t7-/m0/s1.
What are the key properties of (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine?
(1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine has a molecular weight of 199.60 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-chloro-7-nitro-1,2-dihydropyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 86318697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).