About 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate
2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate (PubChem CID 86319343) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate.
Molecular Properties
| Compound Name | 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate |
| PubChem CID | 86319343 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate |
| SMILES | O=C(OCC[C@@H]1CCCCN1)c1ccncc1 |
| InChI | InChI=1S/C13H18N2O2/c16-13(11-4-8-14-9-5-11)17-10-6-12-3-1-2-7-15-12/h4-5,8-9,12,15H,1-3,6-7,10H2/t12-/m0/s1 |
| InChIKey | GUZALBXUKMEQBD-LBPRGKRZSA-N |
| XLogP | 1.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate?
The IUPAC name of 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate (CID 86319343) is 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate.
What is the SMILES notation for 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate?
The canonical SMILES for 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate is O=C(OCC[C@@H]1CCCCN1)c1ccncc1.
What is the InChIKey of 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate?
The InChIKey is GUZALBXUKMEQBD-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H18N2O2/c16-13(11-4-8-14-9-5-11)17-10-6-12-3-1-2-7-15-12/h4-5,8-9,12,15H,1-3,6-7,10H2/t12-/m0/s1.
What are the key properties of 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate?
2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate has a molecular weight of 234.30 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-piperidin-2-yl]ethyl pyridine-4-carboxylate is sourced from PubChem (CID 86319343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).