C11H13Cl2NO — CID 86320973
(3S)-3-[(2,4-dichlorophenoxy)methyl]pyrrolidine (PubChem CID 86320973) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is (3S)-3-[(2,4-dichlorophenoxy)methyl]pyrrolidine.
| Compound Name | (3S)-3-[(2,4-dichlorophenoxy)methyl]pyrrolidine |
|---|---|
| PubChem CID | 86320973 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | (3S)-3-[(2,4-dichlorophenoxy)methyl]pyrrolidine |
| SMILES | Clc1ccc(OC[C@H]2CCNC2)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2NO/c12-9-1-2-11(10(13)5-9)15-7-8-3-4-14-6-8/h1-2,5,8,14H,3-4,6-7H2/t8-/m0/s1 |
| InChIKey | HIHZRVLMCOGOFI-QMMMGPOBSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |