C14H20BrNO — CID 86321717
(3S)-3-[2-[(3-bromophenyl)methoxy]ethyl]piperidine (PubChem CID 86321717) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is (3S)-3-[2-[(3-bromophenyl)methoxy]ethyl]piperidine.
| Compound Name | (3S)-3-[2-[(3-bromophenyl)methoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 86321717 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (3S)-3-[2-[(3-bromophenyl)methoxy]ethyl]piperidine |
| SMILES | Brc1cccc(COCC[C@@H]2CCCNC2)c1 |
| InChI | InChI=1S/C14H20BrNO/c15-14-5-1-3-13(9-14)11-17-8-6-12-4-2-7-16-10-12/h1,3,5,9,12,16H,2,4,6-8,10-11H2/t12-/m0/s1 |
| InChIKey | YJRCONIZLTWSTK-LBPRGKRZSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|