C12H16ClNO — CID 86322321
(3S)-3-(2-chloro-4-ethylphenoxy)pyrrolidine (PubChem CID 86322321) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is (3S)-3-(2-chloro-4-ethylphenoxy)pyrrolidine.
| Compound Name | (3S)-3-(2-chloro-4-ethylphenoxy)pyrrolidine |
|---|---|
| PubChem CID | 86322321 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (3S)-3-(2-chloro-4-ethylphenoxy)pyrrolidine |
| SMILES | CCc1ccc(O[C@H]2CCNC2)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO/c1-2-9-3-4-12(11(13)7-9)15-10-5-6-14-8-10/h3-4,7,10,14H,2,5-6,8H2,1H3/t10-/m0/s1 |
| InChIKey | LQCLJKZYVHBAJN-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |