About (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile
(2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile (PubChem CID 86325247) has the molecular formula C6H8F2N2
and a molecular weight of 146.14 g/mol. Its IUPAC name is (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile.
Molecular Properties
| Compound Name | (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile |
| PubChem CID | 86325247 |
| Molecular Formula | C6H8F2N2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile |
| SMILES | N#C[C@H](N)C1CC(F)(F)C1 |
| InChI | InChI=1S/C6H8F2N2/c7-6(8)1-4(2-6)5(10)3-9/h4-5H,1-2,10H2/t5-/m0/s1 |
| InChIKey | KGGPTXQEQKSAID-YFKPBYRVSA-N |
| XLogP | 0.88 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile?
The IUPAC name of (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile (CID 86325247) is (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile.
What is the SMILES notation for (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile?
The canonical SMILES for (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile is N#C[C@H](N)C1CC(F)(F)C1.
What is the InChIKey of (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile?
The InChIKey is KGGPTXQEQKSAID-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H8F2N2/c7-6(8)1-4(2-6)5(10)3-9/h4-5H,1-2,10H2/t5-/m0/s1.
What are the key properties of (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile?
(2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile has a molecular weight of 146.14 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-(3,3-difluorocyclobutyl)acetonitrile is sourced from PubChem (CID 86325247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).