C16H14ClN3OS — CID 863272
4-benzyl-3-[(4-chlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 863272) has the molecular formula C16H14ClN3OS and a molecular weight of 331.83 g/mol. Its IUPAC name is 4-benzyl-3-[(4-chlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-benzyl-3-[(4-chlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 863272 |
| Molecular Formula | C16H14ClN3OS |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-benzyl-3-[(4-chlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(COc2ccc(Cl)cc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C16H14ClN3OS/c17-13-6-8-14(9-7-13)21-11-15-18-19-16(22)20(15)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,19,22) |
| InChIKey | PQNQVDRTTPICCK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|