About (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine
(2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine (PubChem CID 86327569) has the molecular formula C6H11F3N2
and a molecular weight of 168.16 g/mol. Its IUPAC name is (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine.
Molecular Properties
| Compound Name | (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine |
| PubChem CID | 86327569 |
| Molecular Formula | C6H11F3N2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine |
| SMILES | NC[C@@H](N1CCC1)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2/c7-6(8,9)5(4-10)11-2-1-3-11/h5H,1-4,10H2/t5-/m1/s1 |
| InChIKey | BVVNZGJNHPMVQN-RXMQYKEDSA-N |
| XLogP | 0.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine?
The IUPAC name of (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine (CID 86327569) is (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine.
What is the SMILES notation for (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine?
The canonical SMILES for (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine is NC[C@@H](N1CCC1)C(F)(F)F.
What is the InChIKey of (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine?
The InChIKey is BVVNZGJNHPMVQN-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H11F3N2/c7-6(8,9)5(4-10)11-2-1-3-11/h5H,1-4,10H2/t5-/m1/s1.
What are the key properties of (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine?
(2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine has a molecular weight of 168.16 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(azetidin-1-yl)-3,3,3-trifluoropropan-1-amine is sourced from PubChem (CID 86327569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).