C16H17N5S2 — CID 863284
3-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 863284) has the molecular formula C16H17N5S2 and a molecular weight of 343.48 g/mol. Its IUPAC name is 3-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 863284 |
| Molecular Formula | C16H17N5S2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-n2c(CSc3nc(C)cc(C)n3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C16H17N5S2/c1-10-4-6-13(7-5-10)21-14(19-20-16(21)22)9-23-15-17-11(2)8-12(3)18-15/h4-8H,9H2,1-3H3,(H,20,22) |
| InChIKey | IREMUWMKQDCLPG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|