C8H18N2 — CID 86328477
cis-(1S,3R)-1-N,1-N-dimethylcyclohexane-1,3-diamine (PubChem CID 86328477) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is cis-(1S,3R)-1-N,1-N-dimethylcyclohexane-1,3-diamine.
| Compound Name | cis-(1S,3R)-1-N,1-N-dimethylcyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 86328477 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | cis-(1S,3R)-1-N,1-N-dimethylcyclohexane-1,3-diamine |
| SMILES | CN(C)[C@H]1CCC[C@@H](N)C1 |
| InChI | InChI=1S/C8H18N2/c1-10(2)8-5-3-4-7(9)6-8/h7-8H,3-6,9H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | KKGNWXHXFXNADS-SFYZADRCSA-N |
| XLogP | 0.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |