About 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide (PubChem CID 8633017) has the molecular formula C7H12N4OS2
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide |
| PubChem CID | 8633017 |
| Molecular Formula | C7H12N4OS2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CSc1nnc(N)s1 |
| InChI | InChI=1S/C7H12N4OS2/c1-4(2)9-5(12)3-13-7-11-10-6(8)14-7/h4H,3H2,1-2H3,(H2,8,10)(H,9,12) |
| InChIKey | VVWVLVNAPBZNQR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide?
The IUPAC name of 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide (CID 8633017) is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide?
The canonical SMILES for 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide is CC(C)NC(=O)CSc1nnc(N)s1.
What is the InChIKey of 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide?
The InChIKey is VVWVLVNAPBZNQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4OS2/c1-4(2)9-5(12)3-13-7-11-10-6(8)14-7/h4H,3H2,1-2H3,(H2,8,10)(H,9,12).
What are the key properties of 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide?
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide has a molecular weight of 232.33 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-propan-2-ylacetamide is sourced from PubChem (CID 8633017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).