About tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate
tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate (PubChem CID 86332241) has the molecular formula C10H17F2NO3
and a molecular weight of 237.25 g/mol. Its IUPAC name is tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate.
Analyze tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate?
The IUPAC name of tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate (CID 86332241) is tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate?
The canonical SMILES for tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate is CC(C)(C)OC(=O)N1CC[C@H](O)C(F)(F)C1.
What is the InChIKey of tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate?
The InChIKey is GISYXRBCSOIMTM-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H17F2NO3/c1-9(2,3)16-8(15)13-5-4-7(14)10(11,12)6-13/h7,14H,4-6H2,1-3H3/t7-/m0/s1.
What are the key properties of tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate?
tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate has a molecular weight of 237.25 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate is sourced from PubChem (CID 86332241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).