About (5S)-5-phenyl-1,4-oxazepane
(5S)-5-phenyl-1,4-oxazepane (PubChem CID 86332618) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is (5S)-5-phenyl-1,4-oxazepane.
Molecular Properties
| Compound Name | (5S)-5-phenyl-1,4-oxazepane |
| PubChem CID | 86332618 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (5S)-5-phenyl-1,4-oxazepane |
| SMILES | c1ccc([C@@H]2CCOCCN2)cc1 |
| InChI | InChI=1S/C11H15NO/c1-2-4-10(5-3-1)11-6-8-13-9-7-12-11/h1-5,11-12H,6-9H2/t11-/m0/s1 |
| InChIKey | KNDDKASDDMIEGY-NSHDSACASA-N |
| XLogP | 1.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-phenyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-phenyl-1,4-oxazepane?
The IUPAC name of (5S)-5-phenyl-1,4-oxazepane (CID 86332618) is (5S)-5-phenyl-1,4-oxazepane.
What is the SMILES notation for (5S)-5-phenyl-1,4-oxazepane?
The canonical SMILES for (5S)-5-phenyl-1,4-oxazepane is c1ccc([C@@H]2CCOCCN2)cc1.
What is the InChIKey of (5S)-5-phenyl-1,4-oxazepane?
The InChIKey is KNDDKASDDMIEGY-NSHDSACASA-N. The full InChI is InChI=1S/C11H15NO/c1-2-4-10(5-3-1)11-6-8-13-9-7-12-11/h1-5,11-12H,6-9H2/t11-/m0/s1.
What are the key properties of (5S)-5-phenyl-1,4-oxazepane?
(5S)-5-phenyl-1,4-oxazepane has a molecular weight of 177.25 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-phenyl-1,4-oxazepane is sourced from PubChem (CID 86332618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).