About trans-(1S,3S)-3-fluorocyclohexan-1-amine
trans-(1S,3S)-3-fluorocyclohexan-1-amine (PubChem CID 86333917) has the molecular formula C6H12FN
and a molecular weight of 117.17 g/mol. Its IUPAC name is trans-(1S,3S)-3-fluorocyclohexan-1-amine.
Molecular Properties
| Compound Name | trans-(1S,3S)-3-fluorocyclohexan-1-amine |
| PubChem CID | 86333917 |
| Molecular Formula | C6H12FN |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | trans-(1S,3S)-3-fluorocyclohexan-1-amine |
| SMILES | N[C@H]1CCC[C@H](F)C1 |
| InChI | InChI=1S/C6H12FN/c7-5-2-1-3-6(8)4-5/h5-6H,1-4,8H2/t5-,6-/m0/s1 |
| InChIKey | ZPZKJQKFLQCCMD-WDSKDSINSA-N |
| XLogP | 1.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1S,3S)-3-fluorocyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,3S)-3-fluorocyclohexan-1-amine?
The IUPAC name of trans-(1S,3S)-3-fluorocyclohexan-1-amine (CID 86333917) is trans-(1S,3S)-3-fluorocyclohexan-1-amine.
What is the SMILES notation for trans-(1S,3S)-3-fluorocyclohexan-1-amine?
The canonical SMILES for trans-(1S,3S)-3-fluorocyclohexan-1-amine is N[C@H]1CCC[C@H](F)C1.
What is the InChIKey of trans-(1S,3S)-3-fluorocyclohexan-1-amine?
The InChIKey is ZPZKJQKFLQCCMD-WDSKDSINSA-N. The full InChI is InChI=1S/C6H12FN/c7-5-2-1-3-6(8)4-5/h5-6H,1-4,8H2/t5-,6-/m0/s1.
What are the key properties of trans-(1S,3S)-3-fluorocyclohexan-1-amine?
trans-(1S,3S)-3-fluorocyclohexan-1-amine has a molecular weight of 117.17 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,3S)-3-fluorocyclohexan-1-amine is sourced from PubChem (CID 86333917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).