C15H22N2 — CID 86333935
(9aR)-2-benzyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 86333935) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is (9aR)-2-benzyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (9aR)-2-benzyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 86333935 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (9aR)-2-benzyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | c1ccc(CN2CCN3CCCC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C15H22N2/c1-2-6-14(7-3-1)12-16-10-11-17-9-5-4-8-15(17)13-16/h1-3,6-7,15H,4-5,8-13H2/t15-/m1/s1 |
| InChIKey | IKNPRYWTPFSTAT-OAHLLOKOSA-N |
| XLogP | 2.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |