About 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile
2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile (PubChem CID 86334128) has the molecular formula C13H13N3O
and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile |
| PubChem CID | 86334128 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile |
| SMILES | N#Cc1ccccc1[C@H]1NC2(CCC2)NC1=O |
| InChI | InChI=1S/C13H13N3O/c14-8-9-4-1-2-5-10(9)11-12(17)16-13(15-11)6-3-7-13/h1-2,4-5,11,15H,3,6-7H2,(H,16,17)/t11-/m1/s1 |
| InChIKey | ZSUXXSXUSAHYAS-LLVKDONJSA-N |
| XLogP | 1.20 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile?
The IUPAC name of 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile (CID 86334128) is 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile.
What is the SMILES notation for 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile?
The canonical SMILES for 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile is N#Cc1ccccc1[C@H]1NC2(CCC2)NC1=O.
What is the InChIKey of 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile?
The InChIKey is ZSUXXSXUSAHYAS-LLVKDONJSA-N. The full InChI is InChI=1S/C13H13N3O/c14-8-9-4-1-2-5-10(9)11-12(17)16-13(15-11)6-3-7-13/h1-2,4-5,11,15H,3,6-7H2,(H,16,17)/t11-/m1/s1.
What are the key properties of 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile?
2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile has a molecular weight of 227.27 g/mol, XLogP of 1.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6R)-7-oxo-5,8-diazaspiro[3.4]octan-6-yl]benzonitrile is sourced from PubChem (CID 86334128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).