About (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one
(2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one (PubChem CID 86334224) has the molecular formula C13H15BrN2O
and a molecular weight of 295.18 g/mol. Its IUPAC name is (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one.
Molecular Properties
| Compound Name | (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one |
| PubChem CID | 86334224 |
| Molecular Formula | C13H15BrN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one |
| SMILES | O=C1NC2(CCCC2)N[C@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C13H15BrN2O/c14-10-5-3-4-9(8-10)11-12(17)16-13(15-11)6-1-2-7-13/h3-5,8,11,15H,1-2,6-7H2,(H,16,17)/t11-/m0/s1 |
| InChIKey | BOOFRKQRROOKSN-NSHDSACASA-N |
| XLogP | 2.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one?
The IUPAC name of (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one (CID 86334224) is (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one.
What is the SMILES notation for (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one?
The canonical SMILES for (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one is O=C1NC2(CCCC2)N[C@H]1c1cccc(Br)c1.
What is the InChIKey of (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one?
The InChIKey is BOOFRKQRROOKSN-NSHDSACASA-N. The full InChI is InChI=1S/C13H15BrN2O/c14-10-5-3-4-9(8-10)11-12(17)16-13(15-11)6-1-2-7-13/h3-5,8,11,15H,1-2,6-7H2,(H,16,17)/t11-/m0/s1.
What are the key properties of (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one?
(2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one has a molecular weight of 295.18 g/mol, XLogP of 2.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3-bromophenyl)-1,4-diazaspiro[4.4]nonan-3-one is sourced from PubChem (CID 86334224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).