C10H10Cl3N3O2 — CID 86336226
[(1R)-1-chloroethyl] 2,4-dichloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (PubChem CID 86336226) has the molecular formula C10H10Cl3N3O2 and a molecular weight of 310.57 g/mol. Its IUPAC name is [(1R)-1-chloroethyl] 2,4-dichloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate.
| Compound Name | [(1R)-1-chloroethyl] 2,4-dichloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 86336226 |
| Molecular Formula | C10H10Cl3N3O2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | [(1R)-1-chloroethyl] 2,4-dichloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| SMILES | C[C@@H](Cl)OC(=O)N1CCc2nc(Cl)nc(Cl)c2C1 |
| InChI | InChI=1S/C10H10Cl3N3O2/c1-5(11)18-10(17)16-3-2-7-6(4-16)8(12)15-9(13)14-7/h5H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | HTUVXXIFOPOXHY-YFKPBYRVSA-N |
| XLogP | 2.86 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|