C10H11ClFN — CID 86337458
(1R,2S,3S)-2-(4-chlorophenyl)-3-fluorocyclobutan-1-amine (PubChem CID 86337458) has the molecular formula C10H11ClFN and a molecular weight of 199.66 g/mol. Its IUPAC name is (1R,2S,3S)-2-(4-chlorophenyl)-3-fluorocyclobutan-1-amine.
| Compound Name | (1R,2S,3S)-2-(4-chlorophenyl)-3-fluorocyclobutan-1-amine |
|---|---|
| PubChem CID | 86337458 |
| Molecular Formula | C10H11ClFN |
| Molecular Weight | 199.66 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (1R,2S,3S)-2-(4-chlorophenyl)-3-fluorocyclobutan-1-amine |
| SMILES | N[C@@H]1C[C@H](F)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H11ClFN/c11-7-3-1-6(2-4-7)10-8(12)5-9(10)13/h1-4,8-10H,5,13H2/t8-,9+,10+/m0/s1 |
| InChIKey | JTVGJHJSHXAXSS-IVZWLZJFSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |