About (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine
(7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 86337975) has the molecular formula C8H7Cl2N
and a molecular weight of 188.06 g/mol. Its IUPAC name is (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine.
Molecular Properties
| Compound Name | (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine |
| PubChem CID | 86337975 |
| Molecular Formula | C8H7Cl2N |
| Molecular Weight | 188.06 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | Clc1ccnc2c1CC[C@@H]2Cl |
| InChI | InChI=1S/C8H7Cl2N/c9-6-3-4-11-8-5(6)1-2-7(8)10/h3-4,7H,1-2H2/t7-/m0/s1 |
| InChIKey | ZDQTXRYHERHCDQ-ZETCQYMHSA-N |
| XLogP | 2.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.06 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
The IUPAC name of (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine (CID 86337975) is (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine.
What is the SMILES notation for (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
The canonical SMILES for (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine is Clc1ccnc2c1CC[C@@H]2Cl.
What is the InChIKey of (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
The InChIKey is ZDQTXRYHERHCDQ-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H7Cl2N/c9-6-3-4-11-8-5(6)1-2-7(8)10/h3-4,7H,1-2H2/t7-/m0/s1.
What are the key properties of (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
(7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine has a molecular weight of 188.06 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-4,7-dichloro-6,7-dihydro-5H-cyclopenta[b]pyridine is sourced from PubChem (CID 86337975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).