About (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran
(1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran (PubChem CID 86339095) has the molecular formula C9H9BrO2
and a molecular weight of 229.07 g/mol. Its IUPAC name is (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran |
| PubChem CID | 86339095 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran |
| SMILES | CO[C@@H]1OCc2ccc(Br)cc21 |
| InChI | InChI=1S/C9H9BrO2/c1-11-9-8-4-7(10)3-2-6(8)5-12-9/h2-4,9H,5H2,1H3/t9-/m1/s1 |
| InChIKey | DPCBHHGEVFYHBI-SECBINFHSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran?
The IUPAC name of (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran (CID 86339095) is (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran.
What is the SMILES notation for (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran?
The canonical SMILES for (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran is CO[C@@H]1OCc2ccc(Br)cc21.
What is the InChIKey of (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran?
The InChIKey is DPCBHHGEVFYHBI-SECBINFHSA-N. The full InChI is InChI=1S/C9H9BrO2/c1-11-9-8-4-7(10)3-2-6(8)5-12-9/h2-4,9H,5H2,1H3/t9-/m1/s1.
What are the key properties of (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran?
(1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran has a molecular weight of 229.07 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-6-bromo-1-methoxy-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 86339095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).