About (2S)-2-phenoxyoxolane
(2S)-2-phenoxyoxolane (PubChem CID 86339377) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is (2S)-2-phenoxyoxolane.
Molecular Properties
| Compound Name | (2S)-2-phenoxyoxolane |
| PubChem CID | 86339377 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (2S)-2-phenoxyoxolane |
| SMILES | c1ccc(O[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C10H12O2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-3,5-6,10H,4,7-8H2/t10-/m0/s1 |
| InChIKey | PBCTYXBHPFCNBB-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-phenoxyoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-phenoxyoxolane?
The IUPAC name of (2S)-2-phenoxyoxolane (CID 86339377) is (2S)-2-phenoxyoxolane.
What is the SMILES notation for (2S)-2-phenoxyoxolane?
The canonical SMILES for (2S)-2-phenoxyoxolane is c1ccc(O[C@H]2CCCO2)cc1.
What is the InChIKey of (2S)-2-phenoxyoxolane?
The InChIKey is PBCTYXBHPFCNBB-JTQLQIEISA-N. The full InChI is InChI=1S/C10H12O2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-3,5-6,10H,4,7-8H2/t10-/m0/s1.
What are the key properties of (2S)-2-phenoxyoxolane?
(2S)-2-phenoxyoxolane has a molecular weight of 164.20 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-phenoxyoxolane is sourced from PubChem (CID 86339377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).