C30H22Cl2N2O2 — CID 86340069
8-benzoyl-4-chloro-7-(3-chlorophenyl)-5-phenyl-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one (PubChem CID 86340069) has the molecular formula C30H22Cl2N2O2 and a molecular weight of 513.42 g/mol. Its IUPAC name is 8-benzoyl-4-chloro-7-(3-chlorophenyl)-5-phenyl-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one.
| Compound Name | 8-benzoyl-4-chloro-7-(3-chlorophenyl)-5-phenyl-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one |
|---|---|
| PubChem CID | 86340069 |
| Molecular Formula | C30H22Cl2N2O2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 8-benzoyl-4-chloro-7-(3-chlorophenyl)-5-phenyl-2,8-diazatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one |
| SMILES | O=C(c1ccccc1)N1c2ccccc2N2C(=O)C(Cl)C2(c2ccccc2)CC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C30H22Cl2N2O2/c31-23-15-9-12-21(18-23)26-19-30(22-13-5-2-6-14-22)27(32)29(36)34(30)25-17-8-7-16-24(25)33(26)28(35)20-10-3-1-4-11-20/h1-18,26-27H,19H2 |
| InChIKey | WZLIMKCYPNOKBK-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|