C22H21N3O3 — CID 86340186
2-[1-(cyclopropylmethyl)indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carboxylic acid (PubChem CID 86340186) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethyl)indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-[1-(cyclopropylmethyl)indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 86340186 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[1-(cyclopropylmethyl)indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carboxylic acid |
| SMILES | COc1cc(C(=O)O)cc2nc(-c3cc4ccccc4n3CC3CC3)n(C)c12 |
| InChI | InChI=1S/C22H21N3O3/c1-24-20-16(9-15(22(26)27)11-19(20)28-2)23-21(24)18-10-14-5-3-4-6-17(14)25(18)12-13-7-8-13/h3-6,9-11,13H,7-8,12H2,1-2H3,(H,26,27) |
| InChIKey | NXFFGNWTWZTNLX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |