About tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate
tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate (PubChem CID 86340187) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate |
| PubChem CID | 86340187 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNCC[C@H]1O |
| InChI | InChI=1S/C10H20N2O3/c1-10(2,3)15-9(14)12-7-6-11-5-4-8(7)13/h7-8,11,13H,4-6H2,1-3H3,(H,12,14)/t7-,8+/m0/s1 |
| InChIKey | REUNVCLBHFFYFH-JGVFFNPUSA-N |
| XLogP | 0.23 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate (CID 86340187) is tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate is CC(C)(C)OC(=O)N[C@H]1CNCC[C@H]1O.
What is the InChIKey of tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate?
The InChIKey is REUNVCLBHFFYFH-JGVFFNPUSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-10(2,3)15-9(14)12-7-6-11-5-4-8(7)13/h7-8,11,13H,4-6H2,1-3H3,(H,12,14)/t7-,8+/m0/s1.
What are the key properties of tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate?
tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate has a molecular weight of 216.28 g/mol, XLogP of 0.23, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3S,4R)-4-hydroxypiperidin-3-yl]carbamate is sourced from PubChem (CID 86340187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).