About 4-methyl-1,2-dihydropyridine-3,6-diamine
4-methyl-1,2-dihydropyridine-3,6-diamine (PubChem CID 86340379) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 4-methyl-1,2-dihydropyridine-3,6-diamine.
Molecular Properties
| Compound Name | 4-methyl-1,2-dihydropyridine-3,6-diamine |
| PubChem CID | 86340379 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 4-methyl-1,2-dihydropyridine-3,6-diamine |
| SMILES | CC1=C(N)CNC(N)=C1 |
| InChI | InChI=1S/C6H11N3/c1-4-2-6(8)9-3-5(4)7/h2,9H,3,7-8H2,1H3 |
| InChIKey | YPKHUPSLBHZPEW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1,2-dihydropyridine-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2-dihydropyridine-3,6-diamine?
The IUPAC name of 4-methyl-1,2-dihydropyridine-3,6-diamine (CID 86340379) is 4-methyl-1,2-dihydropyridine-3,6-diamine.
What is the SMILES notation for 4-methyl-1,2-dihydropyridine-3,6-diamine?
The canonical SMILES for 4-methyl-1,2-dihydropyridine-3,6-diamine is CC1=C(N)CNC(N)=C1.
What is the InChIKey of 4-methyl-1,2-dihydropyridine-3,6-diamine?
The InChIKey is YPKHUPSLBHZPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-4-2-6(8)9-3-5(4)7/h2,9H,3,7-8H2,1H3.
What are the key properties of 4-methyl-1,2-dihydropyridine-3,6-diamine?
4-methyl-1,2-dihydropyridine-3,6-diamine has a molecular weight of 125.17 g/mol, XLogP of -0.38, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2-dihydropyridine-3,6-diamine is sourced from PubChem (CID 86340379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).