About [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol
[2-(methylamino)-1,2-dihydropyridin-3-yl]methanol (PubChem CID 86340421) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol.
Molecular Properties
| Compound Name | [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol |
| PubChem CID | 86340421 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol |
| SMILES | CNC1NC=CC=C1CO |
| InChI | InChI=1S/C7H12N2O/c1-8-7-6(5-10)3-2-4-9-7/h2-4,7-10H,5H2,1H3 |
| InChIKey | ANXJVOVRXFPNBM-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol?
The IUPAC name of [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol (CID 86340421) is [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol.
What is the SMILES notation for [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol?
The canonical SMILES for [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol is CNC1NC=CC=C1CO.
What is the InChIKey of [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol?
The InChIKey is ANXJVOVRXFPNBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-8-7-6(5-10)3-2-4-9-7/h2-4,7-10H,5H2,1H3.
What are the key properties of [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol?
[2-(methylamino)-1,2-dihydropyridin-3-yl]methanol has a molecular weight of 140.19 g/mol, XLogP of -0.43, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)-1,2-dihydropyridin-3-yl]methanol is sourced from PubChem (CID 86340421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).