C11H21N3 — CID 86340524
2-N,2-N-dipropyl-1,2-dihydropyridine-2,5-diamine (PubChem CID 86340524) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-N,2-N-dipropyl-1,2-dihydropyridine-2,5-diamine.
| Compound Name | 2-N,2-N-dipropyl-1,2-dihydropyridine-2,5-diamine |
|---|---|
| PubChem CID | 86340524 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 2-N,2-N-dipropyl-1,2-dihydropyridine-2,5-diamine |
| SMILES | CCCN(CCC)C1C=CC(N)=CN1 |
| InChI | InChI=1S/C11H21N3/c1-3-7-14(8-4-2)11-6-5-10(12)9-13-11/h5-6,9,11,13H,3-4,7-8,12H2,1-2H3 |
| InChIKey | YLNFAQUQIREYOR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |