About 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine
2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine (PubChem CID 86340531) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine |
| PubChem CID | 86340531 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine |
| SMILES | CC1CCN(C2C=CC(N)=CN2)CC1 |
| InChI | InChI=1S/C11H19N3/c1-9-4-6-14(7-5-9)11-3-2-10(12)8-13-11/h2-3,8-9,11,13H,4-7,12H2,1H3 |
| InChIKey | MFXYJZKBHPHALB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine?
The IUPAC name of 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine (CID 86340531) is 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine.
What is the SMILES notation for 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine?
The canonical SMILES for 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine is CC1CCN(C2C=CC(N)=CN2)CC1.
What is the InChIKey of 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine?
The InChIKey is MFXYJZKBHPHALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-9-4-6-14(7-5-9)11-3-2-10(12)8-13-11/h2-3,8-9,11,13H,4-7,12H2,1H3.
What are the key properties of 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine?
2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine has a molecular weight of 193.29 g/mol, XLogP of 1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpiperidin-1-yl)-1,2-dihydropyridin-5-amine is sourced from PubChem (CID 86340531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).