About 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol
4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol (PubChem CID 86340592) has the molecular formula C7H7ClN2O
and a molecular weight of 170.60 g/mol. Its IUPAC name is 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol |
| PubChem CID | 86340592 |
| Molecular Formula | C7H7ClN2O |
| Molecular Weight | 170.60 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol |
| SMILES | OC1=C(Cl)c2cc[nH]c2NC1 |
| InChI | InChI=1S/C7H7ClN2O/c8-6-4-1-2-9-7(4)10-3-5(6)11/h1-2,9-11H,3H2 |
| InChIKey | LKMPDORVXHRHJO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol?
The IUPAC name of 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol (CID 86340592) is 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol.
What is the SMILES notation for 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol?
The canonical SMILES for 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol is OC1=C(Cl)c2cc[nH]c2NC1.
What is the InChIKey of 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol?
The InChIKey is LKMPDORVXHRHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O/c8-6-4-1-2-9-7(4)10-3-5(6)11/h1-2,9-11H,3H2.
What are the key properties of 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol?
4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol has a molecular weight of 170.60 g/mol, XLogP of 1.91, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridin-5-ol is sourced from PubChem (CID 86340592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).