About 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine
1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine (PubChem CID 86340617) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine.
Molecular Properties
| Compound Name | 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine |
| PubChem CID | 86340617 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine |
| SMILES | CC1C=C(N2CCNCC2)C=CN1 |
| InChI | InChI=1S/C10H17N3/c1-9-8-10(2-3-12-9)13-6-4-11-5-7-13/h2-3,8-9,11-12H,4-7H2,1H3 |
| InChIKey | RYTQBDZVLRJDQT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine?
The IUPAC name of 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine (CID 86340617) is 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine.
What is the SMILES notation for 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine?
The canonical SMILES for 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine is CC1C=C(N2CCNCC2)C=CN1.
What is the InChIKey of 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine?
The InChIKey is RYTQBDZVLRJDQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-9-8-10(2-3-12-9)13-6-4-11-5-7-13/h2-3,8-9,11-12H,4-7H2,1H3.
What are the key properties of 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine?
1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine has a molecular weight of 179.27 g/mol, XLogP of 0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-1,2-dihydropyridin-4-yl)piperazine is sourced from PubChem (CID 86340617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).