About N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide
N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide (PubChem CID 86340852) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide |
| PubChem CID | 86340852 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide |
| SMILES | CC(=O)NC1=C(C)C=C(N)NC1 |
| InChI | InChI=1S/C8H13N3O/c1-5-3-8(9)10-4-7(5)11-6(2)12/h3,10H,4,9H2,1-2H3,(H,11,12) |
| InChIKey | ZKOVXRLGKGYZPU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide?
The IUPAC name of N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide (CID 86340852) is N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide.
What is the SMILES notation for N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide?
The canonical SMILES for N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide is CC(=O)NC1=C(C)C=C(N)NC1.
What is the InChIKey of N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide?
The InChIKey is ZKOVXRLGKGYZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-5-3-8(9)10-4-7(5)11-6(2)12/h3,10H,4,9H2,1-2H3,(H,11,12).
What are the key properties of N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide?
N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide has a molecular weight of 167.21 g/mol, XLogP of -0.20, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-4-methyl-1,2-dihydropyridin-3-yl)acetamide is sourced from PubChem (CID 86340852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).